C25H29NO2 — CID 13080300
(3-anilinophenyl)methyl 3-(cyclopentylidenemethyl)-2,2-dimethylcyclopropane-1-carboxylate (PubChem CID 13080300) has the molecular formula C25H29NO2 and a molecular weight of 375.51 g/mol. Its IUPAC name is (3-anilinophenyl)methyl 3-(cyclopentylidenemethyl)-2,2-dimethylcyclopropane-1-carboxylate.
| Compound Name | (3-anilinophenyl)methyl 3-(cyclopentylidenemethyl)-2,2-dimethylcyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 13080300 |
| Molecular Formula | C25H29NO2 |
| Molecular Weight | 375.51 g/mol |
| Exact Mass | 375.22 |
| IUPAC Name | (3-anilinophenyl)methyl 3-(cyclopentylidenemethyl)-2,2-dimethylcyclopropane-1-carboxylate |
| SMILES | CC1(C)C(C=C2CCCC2)C1C(=O)OCc1cccc(Nc2ccccc2)c1 |
| InChI | InChI=1S/C25H29NO2/c1-25(2)22(16-18-9-6-7-10-18)23(25)24(27)28-17-19-11-8-14-21(15-19)26-20-12-4-3-5-13-20/h3-5,8,11-16,22-23,26H,6-7,9-10,17H2,1-2H3 |
| InChIKey | PPPOXWALLBQAAU-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.51 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|