C23H24O4S — CID 6089304
(5-benzylfuran-3-yl)methyl 2,2-dimethyl-3-[(Z)-(2-oxothiolan-3-ylidene)methyl]cyclopropane-1-carboxylate (PubChem CID 6089304) has the molecular formula C23H24O4S and a molecular weight of 396.51 g/mol. Its IUPAC name is (5-benzylfuran-3-yl)methyl 2,2-dimethyl-3-[(Z)-(2-oxothiolan-3-ylidene)methyl]cyclopropane-1-carboxylate.
| Compound Name | (5-benzylfuran-3-yl)methyl 2,2-dimethyl-3-[(Z)-(2-oxothiolan-3-ylidene)methyl]cyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 6089304 |
| Molecular Formula | C23H24O4S |
| Molecular Weight | 396.51 g/mol |
| Exact Mass | 396.14 |
| IUPAC Name | (5-benzylfuran-3-yl)methyl 2,2-dimethyl-3-[(Z)-(2-oxothiolan-3-ylidene)methyl]cyclopropane-1-carboxylate |
| SMILES | CC1(C)C(/C=C2/CCSC2=O)C1C(=O)OCc1coc(Cc2ccccc2)c1 |
| InChI | InChI=1S/C23H24O4S/c1-23(2)19(12-17-8-9-28-22(17)25)20(23)21(24)27-14-16-11-18(26-13-16)10-15-6-4-3-5-7-15/h3-7,11-13,19-20H,8-10,14H2,1-2H3/b17-12- |
| InChIKey | UGWALRUNBSBTGI-ATVHPVEESA-N |
| XLogP | 4.78 |
| TPSA | 56.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.51 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|