C11H15ClO — CID 45081793
trans-(1R,3S)-3-(cyclobutylidenemethyl)-2,2-dimethylcyclopropane-1-carbonyl chloride (PubChem CID 45081793) has the molecular formula C11H15ClO and a molecular weight of 198.69 g/mol. Its IUPAC name is trans-(1R,3S)-3-(cyclobutylidenemethyl)-2,2-dimethylcyclopropane-1-carbonyl chloride.
| Compound Name | trans-(1R,3S)-3-(cyclobutylidenemethyl)-2,2-dimethylcyclopropane-1-carbonyl chloride |
|---|---|
| PubChem CID | 45081793 |
| Molecular Formula | C11H15ClO |
| Molecular Weight | 198.69 g/mol |
| Exact Mass | 198.08 |
| IUPAC Name | trans-(1R,3S)-3-(cyclobutylidenemethyl)-2,2-dimethylcyclopropane-1-carbonyl chloride |
| SMILES | CC1(C)[C@H](C(=O)Cl)[C@@H]1C=C1CCC1 |
| InChI | InChI=1S/C11H15ClO/c1-11(2)8(9(11)10(12)13)6-7-4-3-5-7/h6,8-9H,3-5H2,1-2H3/t8-,9-/m0/s1 |
| InChIKey | MNZUPMXXCJNHQQ-IUCAKERBSA-N |
| XLogP | 3.13 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.69 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|