C12H17ClO2 — CID 70504052
trans-(1R,3R)-1-chloro-3-(cyclopentylidenemethyl)-2,2-dimethylcyclopropane-1-carboxylic acid (PubChem CID 70504052) has the molecular formula C12H17ClO2 and a molecular weight of 228.72 g/mol. Its IUPAC name is trans-(1R,3R)-1-chloro-3-(cyclopentylidenemethyl)-2,2-dimethylcyclopropane-1-carboxylic acid.
| Compound Name | trans-(1R,3R)-1-chloro-3-(cyclopentylidenemethyl)-2,2-dimethylcyclopropane-1-carboxylic acid |
|---|---|
| PubChem CID | 70504052 |
| Molecular Formula | C12H17ClO2 |
| Molecular Weight | 228.72 g/mol |
| Exact Mass | 228.09 |
| IUPAC Name | trans-(1R,3R)-1-chloro-3-(cyclopentylidenemethyl)-2,2-dimethylcyclopropane-1-carboxylic acid |
| SMILES | CC1(C)[C@@H](C=C2CCCC2)[C@]1(Cl)C(=O)O |
| InChI | InChI=1S/C12H17ClO2/c1-11(2)9(12(11,13)10(14)15)7-8-5-3-4-6-8/h7,9H,3-6H2,1-2H3,(H,14,15)/t9-,12+/m1/s1 |
| InChIKey | OFEXHLNBTOPWRE-SKDRFNHKSA-N |
| XLogP | 3.20 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.72 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|