C11H14ClF3O3 — CID 57074472
1-chloro-3-(2-ethoxy-3,3,3-trifluoroprop-1-enyl)-2,2-dimethylcyclopropane-1-carboxylic acid (PubChem CID 57074472) has the molecular formula C11H14ClF3O3 and a molecular weight of 286.68 g/mol. Its IUPAC name is 1-chloro-3-(2-ethoxy-3,3,3-trifluoroprop-1-enyl)-2,2-dimethylcyclopropane-1-carboxylic acid.
| Compound Name | 1-chloro-3-(2-ethoxy-3,3,3-trifluoroprop-1-enyl)-2,2-dimethylcyclopropane-1-carboxylic acid |
|---|---|
| PubChem CID | 57074472 |
| Molecular Formula | C11H14ClF3O3 |
| Molecular Weight | 286.68 g/mol |
| Exact Mass | 286.06 |
| IUPAC Name | 1-chloro-3-(2-ethoxy-3,3,3-trifluoroprop-1-enyl)-2,2-dimethylcyclopropane-1-carboxylic acid |
| SMILES | CCOC(=CC1C(C)(C)C1(Cl)C(=O)O)C(F)(F)F |
| InChI | InChI=1S/C11H14ClF3O3/c1-4-18-7(11(13,14)15)5-6-9(2,3)10(6,12)8(16)17/h5-6H,4H2,1-3H3,(H,16,17) |
| InChIKey | OXODJASJLHSCEU-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.68 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|