C8H9F3O3 — CID 166561105
cis-ethyl (1S,2R)-2-formyl-1-(trifluoromethyl)cyclopropane-1-carboxylate (PubChem CID 166561105) has the molecular formula C8H9F3O3 and a molecular weight of 210.15 g/mol. Its IUPAC name is cis-ethyl (1S,2R)-2-formyl-1-(trifluoromethyl)cyclopropane-1-carboxylate.
| Compound Name | cis-ethyl (1S,2R)-2-formyl-1-(trifluoromethyl)cyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 166561105 |
| Molecular Formula | C8H9F3O3 |
| Molecular Weight | 210.15 g/mol |
| Exact Mass | 210.05 |
| IUPAC Name | cis-ethyl (1S,2R)-2-formyl-1-(trifluoromethyl)cyclopropane-1-carboxylate |
| SMILES | CCOC(=O)[C@]1(C(F)(F)F)C[C@H]1C=O |
| InChI | InChI=1S/C8H9F3O3/c1-2-14-6(13)7(8(9,10)11)3-5(7)4-12/h4-5H,2-3H2,1H3/t5-,7-/m0/s1 |
| InChIKey | ODEQNBUXHIPOGN-FSPLSTOPSA-N |
| XLogP | 1.32 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.15 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|