About cis-ethyl (1S,2R)-2-formyl-1-(trifluoromethyl)cyclopropane-1-carboxylate
cis-ethyl (1S,2R)-2-formyl-1-(trifluoromethyl)cyclopropane-1-carboxylate (PubChem CID 166561105) has the molecular formula C8H9F3O3
and a molecular weight of 210.15 g/mol. Its IUPAC name is cis-ethyl (1S,2R)-2-formyl-1-(trifluoromethyl)cyclopropane-1-carboxylate.
Molecular Properties
| Compound Name | cis-ethyl (1S,2R)-2-formyl-1-(trifluoromethyl)cyclopropane-1-carboxylate |
| PubChem CID | 166561105 |
| Molecular Formula | C8H9F3O3 |
| Molecular Weight | 210.15 g/mol |
| Exact Mass | 210.05 |
| IUPAC Name | cis-ethyl (1S,2R)-2-formyl-1-(trifluoromethyl)cyclopropane-1-carboxylate |
| SMILES | CCOC(=O)[C@]1(C(F)(F)F)C[C@H]1C=O |
| InChI | InChI=1S/C8H9F3O3/c1-2-14-6(13)7(8(9,10)11)3-5(7)4-12/h4-5H,2-3H2,1H3/t5-,7-/m0/s1 |
| InChIKey | ODEQNBUXHIPOGN-FSPLSTOPSA-N |
| XLogP | 1.32 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.15 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze cis-ethyl (1S,2R)-2-formyl-1-(trifluoromethyl)cyclopropane-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cis-ethyl (1S,2R)-2-formyl-1-(trifluoromethyl)cyclopropane-1-carboxylate?
The IUPAC name of cis-ethyl (1S,2R)-2-formyl-1-(trifluoromethyl)cyclopropane-1-carboxylate (CID 166561105) is cis-ethyl (1S,2R)-2-formyl-1-(trifluoromethyl)cyclopropane-1-carboxylate.
What is the SMILES notation for cis-ethyl (1S,2R)-2-formyl-1-(trifluoromethyl)cyclopropane-1-carboxylate?
The canonical SMILES for cis-ethyl (1S,2R)-2-formyl-1-(trifluoromethyl)cyclopropane-1-carboxylate is CCOC(=O)[C@]1(C(F)(F)F)C[C@H]1C=O.
What is the InChIKey of cis-ethyl (1S,2R)-2-formyl-1-(trifluoromethyl)cyclopropane-1-carboxylate?
The InChIKey is ODEQNBUXHIPOGN-FSPLSTOPSA-N. The full InChI is InChI=1S/C8H9F3O3/c1-2-14-6(13)7(8(9,10)11)3-5(7)4-12/h4-5H,2-3H2,1H3/t5-,7-/m0/s1.
What are the key properties of cis-ethyl (1S,2R)-2-formyl-1-(trifluoromethyl)cyclopropane-1-carboxylate?
cis-ethyl (1S,2R)-2-formyl-1-(trifluoromethyl)cyclopropane-1-carboxylate has a molecular weight of 210.15 g/mol, XLogP of 1.32, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for cis-ethyl (1S,2R)-2-formyl-1-(trifluoromethyl)cyclopropane-1-carboxylate is sourced from PubChem (CID 166561105), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).