C11H16O5 — CID 15564239
trans-diethyl (2R,3R)-2-formyl-3-methylcyclopropane-1,1-dicarboxylate (PubChem CID 15564239) has the molecular formula C11H16O5 and a molecular weight of 228.24 g/mol. Its IUPAC name is trans-diethyl (2R,3R)-2-formyl-3-methylcyclopropane-1,1-dicarboxylate.
| Compound Name | trans-diethyl (2R,3R)-2-formyl-3-methylcyclopropane-1,1-dicarboxylate |
|---|---|
| PubChem CID | 15564239 |
| Molecular Formula | C11H16O5 |
| Molecular Weight | 228.24 g/mol |
| Exact Mass | 228.10 |
| IUPAC Name | trans-diethyl (2R,3R)-2-formyl-3-methylcyclopropane-1,1-dicarboxylate |
| SMILES | CCOC(=O)C1(C(=O)OCC)[C@H](C)[C@H]1C=O |
| InChI | InChI=1S/C11H16O5/c1-4-15-9(13)11(10(14)16-5-2)7(3)8(11)6-12/h6-8H,4-5H2,1-3H3/t7-,8-/m1/s1 |
| InChIKey | FJANMSWMJJHKTN-HTQZYQBOSA-N |
| XLogP | 0.56 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.24 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|