C16H21NO4 — CID 71534375
ethyl (3R,4S,5R)-2-benzyl-4-formyl-3,5-dimethyl-1,2-oxazolidine-3-carboxylate (PubChem CID 71534375) has the molecular formula C16H21NO4 and a molecular weight of 291.35 g/mol. Its IUPAC name is ethyl (3R,4S,5R)-2-benzyl-4-formyl-3,5-dimethyl-1,2-oxazolidine-3-carboxylate.
| Compound Name | ethyl (3R,4S,5R)-2-benzyl-4-formyl-3,5-dimethyl-1,2-oxazolidine-3-carboxylate |
|---|---|
| PubChem CID | 71534375 |
| Molecular Formula | C16H21NO4 |
| Molecular Weight | 291.35 g/mol |
| Exact Mass | 291.15 |
| IUPAC Name | ethyl (3R,4S,5R)-2-benzyl-4-formyl-3,5-dimethyl-1,2-oxazolidine-3-carboxylate |
| SMILES | CCOC(=O)[C@@]1(C)[C@H](C=O)[C@@H](C)ON1Cc1ccccc1 |
| InChI | InChI=1S/C16H21NO4/c1-4-20-15(19)16(3)14(11-18)12(2)21-17(16)10-13-8-6-5-7-9-13/h5-9,11-12,14H,4,10H2,1-3H3/t12-,14-,16-/m1/s1 |
| InChIKey | UBVTWUNWHBLMGW-XNRPHZJLSA-N |
| XLogP | 1.96 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.35 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|