C20H21NO4 — CID 102416371
benzyl (3S,4S,5R)-2-benzyl-4-formyl-5-methyl-1,2-oxazolidine-3-carboxylate (PubChem CID 102416371) has the molecular formula C20H21NO4 and a molecular weight of 339.39 g/mol. Its IUPAC name is benzyl (3S,4S,5R)-2-benzyl-4-formyl-5-methyl-1,2-oxazolidine-3-carboxylate.
| Compound Name | benzyl (3S,4S,5R)-2-benzyl-4-formyl-5-methyl-1,2-oxazolidine-3-carboxylate |
|---|---|
| PubChem CID | 102416371 |
| Molecular Formula | C20H21NO4 |
| Molecular Weight | 339.39 g/mol |
| Exact Mass | 339.15 |
| IUPAC Name | benzyl (3S,4S,5R)-2-benzyl-4-formyl-5-methyl-1,2-oxazolidine-3-carboxylate |
| SMILES | C[C@H]1ON(Cc2ccccc2)[C@H](C(=O)OCc2ccccc2)[C@@H]1C=O |
| InChI | InChI=1S/C20H21NO4/c1-15-18(13-22)19(20(23)24-14-17-10-6-3-7-11-17)21(25-15)12-16-8-4-2-5-9-16/h2-11,13,15,18-19H,12,14H2,1H3/t15-,18-,19+/m1/s1 |
| InChIKey | BVCKVGPJZMWYAE-LZQZEXGQSA-N |
| XLogP | 2.75 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.39 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|