C11H12O5 — CID 11148799
(1R,5S,6R)-1-ethoxycarbonyl-6-formylbicyclo[3.1.0]hex-2-ene-2-carboxylic acid (PubChem CID 11148799) has the molecular formula C11H12O5 and a molecular weight of 224.21 g/mol. Its IUPAC name is (1R,5S,6R)-1-ethoxycarbonyl-6-formylbicyclo[3.1.0]hex-2-ene-2-carboxylic acid.
| Compound Name | (1R,5S,6R)-1-ethoxycarbonyl-6-formylbicyclo[3.1.0]hex-2-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 11148799 |
| Molecular Formula | C11H12O5 |
| Molecular Weight | 224.21 g/mol |
| Exact Mass | 224.07 |
| IUPAC Name | (1R,5S,6R)-1-ethoxycarbonyl-6-formylbicyclo[3.1.0]hex-2-ene-2-carboxylic acid |
| SMILES | CCOC(=O)[C@]12C(C(=O)O)=CC[C@H]1[C@H]2C=O |
| InChI | InChI=1S/C11H12O5/c1-2-16-10(15)11-6(8(11)5-12)3-4-7(11)9(13)14/h4-6,8H,2-3H2,1H3,(H,13,14)/t6-,8+,11-/m0/s1 |
| InChIKey | NZQUFJZNNWYULI-QXHCQDJKSA-N |
| XLogP | 0.40 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.21 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|