C15H22O2Si — CID 101464653
cis-ethyl (1R,2R)-1-[dimethyl(phenyl)silyl]-2-methylcyclopropane-1-carboxylate (PubChem CID 101464653) has the molecular formula C15H22O2Si and a molecular weight of 262.43 g/mol. Its IUPAC name is cis-ethyl (1R,2R)-1-[dimethyl(phenyl)silyl]-2-methylcyclopropane-1-carboxylate.
| Compound Name | cis-ethyl (1R,2R)-1-[dimethyl(phenyl)silyl]-2-methylcyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 101464653 |
| Molecular Formula | C15H22O2Si |
| Molecular Weight | 262.43 g/mol |
| Exact Mass | 262.14 |
| IUPAC Name | cis-ethyl (1R,2R)-1-[dimethyl(phenyl)silyl]-2-methylcyclopropane-1-carboxylate |
| SMILES | CCOC(=O)[C@@]1([Si](C)(C)c2ccccc2)C[C@H]1C |
| InChI | InChI=1S/C15H22O2Si/c1-5-17-14(16)15(11-12(15)2)18(3,4)13-9-7-6-8-10-13/h6-10,12H,5,11H2,1-4H3/t12-,15-/m1/s1 |
| InChIKey | GDWZGKFWSAJWCZ-IUODEOHRSA-N |
| XLogP | 2.95 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.43 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|