C28H44O4SiSn — CID 177464662
trans-diethyl (3R,4R)-3-[(E)-3-[dimethyl(phenyl)silyl]prop-1-enyl]-4-[(E)-3-trimethylstannylprop-1-enyl]cyclopentane-1,1-dicarboxylate (PubChem CID 177464662) has the molecular formula C28H44O4SiSn and a molecular weight of 591.45 g/mol. Its IUPAC name is trans-diethyl (3R,4R)-3-[(E)-3-[dimethyl(phenyl)silyl]prop-1-enyl]-4-[(E)-3-trimethylstannylprop-1-enyl]cyclopentane-1,1-dicarboxylate.
| Compound Name | trans-diethyl (3R,4R)-3-[(E)-3-[dimethyl(phenyl)silyl]prop-1-enyl]-4-[(E)-3-trimethylstannylprop-1-enyl]cyclopentane-1,1-dicarboxylate |
|---|---|
| PubChem CID | 177464662 |
| Molecular Formula | C28H44O4SiSn |
| Molecular Weight | 591.45 g/mol |
| Exact Mass | 592.20 |
| IUPAC Name | trans-diethyl (3R,4R)-3-[(E)-3-[dimethyl(phenyl)silyl]prop-1-enyl]-4-[(E)-3-trimethylstannylprop-1-enyl]cyclopentane-1,1-dicarboxylate |
| SMILES | CCOC(=O)C1(C(=O)OCC)C[C@H](/C=C/C[Si](C)(C)c2ccccc2)[C@@H](/C=C/C[Sn](C)(C)C)C1 |
| InChI | InChI=1S/C25H35O4Si.3CH3.Sn/c1-6-13-20-18-25(23(26)28-7-2,24(27)29-8-3)19-21(20)14-12-17-30(4,5)22-15-10-9-11-16-22;;;;/h6,9-16,20-21H,1,7-8,17-19H2,2-5H3;3*1H3;/b13-6+,14-12+;;;;/t20-,21-;;;;/m0..../s1 |
| InChIKey | VGUBYXWRYSUBPB-JNTNFIAXSA-N |
| XLogP | 6.19 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.45 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|