C27H41BO6Si — CID 139790362
diethyl 3-[[dimethyl(phenyl)silyl]methyl]-4-[(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methylidene]cyclopentane-1,1-dicarboxylate (PubChem CID 139790362) has the molecular formula C27H41BO6Si and a molecular weight of 500.52 g/mol. Its IUPAC name is diethyl 3-[[dimethyl(phenyl)silyl]methyl]-4-[(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methylidene]cyclopentane-1,1-dicarboxylate.
| Compound Name | diethyl 3-[[dimethyl(phenyl)silyl]methyl]-4-[(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methylidene]cyclopentane-1,1-dicarboxylate |
|---|---|
| PubChem CID | 139790362 |
| Molecular Formula | C27H41BO6Si |
| Molecular Weight | 500.52 g/mol |
| Exact Mass | 500.28 |
| IUPAC Name | diethyl 3-[[dimethyl(phenyl)silyl]methyl]-4-[(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methylidene]cyclopentane-1,1-dicarboxylate |
| SMILES | CCOC(=O)C1(C(=O)OCC)CC(=CB2OC(C)(C)C(C)(C)O2)C(C[Si](C)(C)c2ccccc2)C1 |
| InChI | InChI=1S/C27H41BO6Si/c1-9-31-23(29)27(24(30)32-10-2)16-20(18-28-33-25(3,4)26(5,6)34-28)21(17-27)19-35(7,8)22-14-12-11-13-15-22/h11-15,18,21H,9-10,16-17,19H2,1-8H3 |
| InChIKey | LGXHQNZGMDZXCJ-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.52 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|