C19H28O4Si — CID 11783022
cis-dimethyl (3R,4R)-3-[[dimethyl(phenyl)silyl]methyl]-4-methylcyclopentane-1,1-dicarboxylate (PubChem CID 11783022) has the molecular formula C19H28O4Si and a molecular weight of 348.51 g/mol. Its IUPAC name is cis-dimethyl (3R,4R)-3-[[dimethyl(phenyl)silyl]methyl]-4-methylcyclopentane-1,1-dicarboxylate.
| Compound Name | cis-dimethyl (3R,4R)-3-[[dimethyl(phenyl)silyl]methyl]-4-methylcyclopentane-1,1-dicarboxylate |
|---|---|
| PubChem CID | 11783022 |
| Molecular Formula | C19H28O4Si |
| Molecular Weight | 348.51 g/mol |
| Exact Mass | 348.18 |
| IUPAC Name | cis-dimethyl (3R,4R)-3-[[dimethyl(phenyl)silyl]methyl]-4-methylcyclopentane-1,1-dicarboxylate |
| SMILES | COC(=O)C1(C(=O)OC)C[C@@H](C[Si](C)(C)c2ccccc2)[C@H](C)C1 |
| InChI | InChI=1S/C19H28O4Si/c1-14-11-19(17(20)22-2,18(21)23-3)12-15(14)13-24(4,5)16-9-7-6-8-10-16/h6-10,14-15H,11-13H2,1-5H3/t14-,15+/m1/s1 |
| InChIKey | OJKLNRBDWYACTF-CABCVRRESA-N |
| XLogP | 2.98 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.51 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|