C18H26O4Si — CID 102278456
trans-dimethyl (2R,3S)-3-[dimethyl(phenyl)silyl]-2-methylcyclopentane-1,1-dicarboxylate (PubChem CID 102278456) has the molecular formula C18H26O4Si and a molecular weight of 334.49 g/mol. Its IUPAC name is trans-dimethyl (2R,3S)-3-[dimethyl(phenyl)silyl]-2-methylcyclopentane-1,1-dicarboxylate.
| Compound Name | trans-dimethyl (2R,3S)-3-[dimethyl(phenyl)silyl]-2-methylcyclopentane-1,1-dicarboxylate |
|---|---|
| PubChem CID | 102278456 |
| Molecular Formula | C18H26O4Si |
| Molecular Weight | 334.49 g/mol |
| Exact Mass | 334.16 |
| IUPAC Name | trans-dimethyl (2R,3S)-3-[dimethyl(phenyl)silyl]-2-methylcyclopentane-1,1-dicarboxylate |
| SMILES | COC(=O)C1(C(=O)OC)CC[C@H]([Si](C)(C)c2ccccc2)[C@@H]1C |
| InChI | InChI=1S/C18H26O4Si/c1-13-15(23(4,5)14-9-7-6-8-10-14)11-12-18(13,16(19)21-2)17(20)22-3/h6-10,13,15H,11-12H2,1-5H3/t13-,15-/m0/s1 |
| InChIKey | NXSNOSJJPXSQHG-ZFWWWQNUSA-N |
| XLogP | 2.73 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.49 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|