C16H17NO5 — CID 101413354
dimethyl (3aR,6R)-6-phenyl-3,3a,4,6-tetrahydrocyclopenta[c][1,2]oxazole-5,5-dicarboxylate (PubChem CID 101413354) has the molecular formula C16H17NO5 and a molecular weight of 303.31 g/mol. Its IUPAC name is dimethyl (3aR,6R)-6-phenyl-3,3a,4,6-tetrahydrocyclopenta[c][1,2]oxazole-5,5-dicarboxylate.
| Compound Name | dimethyl (3aR,6R)-6-phenyl-3,3a,4,6-tetrahydrocyclopenta[c][1,2]oxazole-5,5-dicarboxylate |
|---|---|
| PubChem CID | 101413354 |
| Molecular Formula | C16H17NO5 |
| Molecular Weight | 303.31 g/mol |
| Exact Mass | 303.11 |
| IUPAC Name | dimethyl (3aR,6R)-6-phenyl-3,3a,4,6-tetrahydrocyclopenta[c][1,2]oxazole-5,5-dicarboxylate |
| SMILES | COC(=O)C1(C(=O)OC)C[C@H]2CON=C2[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C16H17NO5/c1-20-14(18)16(15(19)21-2)8-11-9-22-17-13(11)12(16)10-6-4-3-5-7-10/h3-7,11-12H,8-9H2,1-2H3/t11-,12-/m0/s1 |
| InChIKey | QVOQGBRUUZCFID-RYUDHWBXSA-N |
| XLogP | 1.51 |
| TPSA | 74.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.31 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|