C15H18O3 — CID 145071818
methyl 1-(1-methoxyethenyl)-2-phenylcyclobutane-1-carboxylate (PubChem CID 145071818) has the molecular formula C15H18O3 and a molecular weight of 246.31 g/mol. Its IUPAC name is methyl 1-(1-methoxyethenyl)-2-phenylcyclobutane-1-carboxylate.
| Compound Name | methyl 1-(1-methoxyethenyl)-2-phenylcyclobutane-1-carboxylate |
|---|---|
| PubChem CID | 145071818 |
| Molecular Formula | C15H18O3 |
| Molecular Weight | 246.31 g/mol |
| Exact Mass | 246.13 |
| IUPAC Name | methyl 1-(1-methoxyethenyl)-2-phenylcyclobutane-1-carboxylate |
| SMILES | C=C(OC)C1(C(=O)OC)CCC1c1ccccc1 |
| InChI | InChI=1S/C15H18O3/c1-11(17-2)15(14(16)18-3)10-9-13(15)12-7-5-4-6-8-12/h4-8,13H,1,9-10H2,2-3H3 |
| InChIKey | LWTHUVPDHBUPLV-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.31 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|