C18H15FO3 — CID 44557655
cis-methyl (1R,2R)-1-(4-fluorobenzoyl)-2-phenylcyclopropane-1-carboxylate (PubChem CID 44557655) has the molecular formula C18H15FO3 and a molecular weight of 298.31 g/mol. Its IUPAC name is cis-methyl (1R,2R)-1-(4-fluorobenzoyl)-2-phenylcyclopropane-1-carboxylate.
| Compound Name | cis-methyl (1R,2R)-1-(4-fluorobenzoyl)-2-phenylcyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 44557655 |
| Molecular Formula | C18H15FO3 |
| Molecular Weight | 298.31 g/mol |
| Exact Mass | 298.10 |
| IUPAC Name | cis-methyl (1R,2R)-1-(4-fluorobenzoyl)-2-phenylcyclopropane-1-carboxylate |
| SMILES | COC(=O)[C@]1(C(=O)c2ccc(F)cc2)C[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C18H15FO3/c1-22-17(21)18(11-15(18)12-5-3-2-4-6-12)16(20)13-7-9-14(19)10-8-13/h2-10,15H,11H2,1H3/t15-,18-/m1/s1 |
| InChIKey | PNWZKAONKBRJSM-CRAIPNDOSA-N |
| XLogP | 3.36 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.31 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|