C14H16O5 — CID 132540324
dimethyl 2-(3-methoxyphenyl)cyclopropane-1,1-dicarboxylate (PubChem CID 132540324) has the molecular formula C14H16O5 and a molecular weight of 264.28 g/mol. Its IUPAC name is dimethyl 2-(3-methoxyphenyl)cyclopropane-1,1-dicarboxylate.
| Compound Name | dimethyl 2-(3-methoxyphenyl)cyclopropane-1,1-dicarboxylate |
|---|---|
| PubChem CID | 132540324 |
| Molecular Formula | C14H16O5 |
| Molecular Weight | 264.28 g/mol |
| Exact Mass | 264.10 |
| IUPAC Name | dimethyl 2-(3-methoxyphenyl)cyclopropane-1,1-dicarboxylate |
| SMILES | COC(=O)C1(C(=O)OC)CC1c1cccc(OC)c1 |
| InChI | InChI=1S/C14H16O5/c1-17-10-6-4-5-9(7-10)11-8-14(11,12(15)18-2)13(16)19-3/h4-7,11H,8H2,1-3H3 |
| InChIKey | PBQUZCHEEZELFF-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.28 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|