C20H29NO3 — CID 176682722
tert-butyl 4-amino-3-(3-methoxyphenyl)bicyclo[2.2.2]octane-1-carboxylate (PubChem CID 176682722) has the molecular formula C20H29NO3 and a molecular weight of 331.46 g/mol. Its IUPAC name is tert-butyl 4-amino-3-(3-methoxyphenyl)bicyclo[2.2.2]octane-1-carboxylate.
| Compound Name | tert-butyl 4-amino-3-(3-methoxyphenyl)bicyclo[2.2.2]octane-1-carboxylate |
|---|---|
| PubChem CID | 176682722 |
| Molecular Formula | C20H29NO3 |
| Molecular Weight | 331.46 g/mol |
| Exact Mass | 331.21 |
| IUPAC Name | tert-butyl 4-amino-3-(3-methoxyphenyl)bicyclo[2.2.2]octane-1-carboxylate |
| SMILES | COc1cccc(C2CC3(C(=O)OC(C)(C)C)CCC2(N)CC3)c1 |
| InChI | InChI=1S/C20H29NO3/c1-18(2,3)24-17(22)19-8-10-20(21,11-9-19)16(13-19)14-6-5-7-15(12-14)23-4/h5-7,12,16H,8-11,13,21H2,1-4H3 |
| InChIKey | CUZIEQIPNQSJBK-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.46 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |