C20H29NO2 — CID 176682718
tert-butyl 4-amino-3-(4-methylphenyl)bicyclo[2.2.2]octane-1-carboxylate (PubChem CID 176682718) has the molecular formula C20H29NO2 and a molecular weight of 315.46 g/mol. Its IUPAC name is tert-butyl 4-amino-3-(4-methylphenyl)bicyclo[2.2.2]octane-1-carboxylate.
| Compound Name | tert-butyl 4-amino-3-(4-methylphenyl)bicyclo[2.2.2]octane-1-carboxylate |
|---|---|
| PubChem CID | 176682718 |
| Molecular Formula | C20H29NO2 |
| Molecular Weight | 315.46 g/mol |
| Exact Mass | 315.22 |
| IUPAC Name | tert-butyl 4-amino-3-(4-methylphenyl)bicyclo[2.2.2]octane-1-carboxylate |
| SMILES | Cc1ccc(C2CC3(C(=O)OC(C)(C)C)CCC2(N)CC3)cc1 |
| InChI | InChI=1S/C20H29NO2/c1-14-5-7-15(8-6-14)16-13-19(17(22)23-18(2,3)4)9-11-20(16,21)12-10-19/h5-8,16H,9-13,21H2,1-4H3 |
| InChIKey | NOBVCAWAJARHRB-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.46 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |