C23H22N2O5 — CID 46188325
dimethyl 2-[3-(3-methoxyphenyl)-5-phenyl-1H-pyrazol-4-yl]cyclopropane-1,1-dicarboxylate (PubChem CID 46188325) has the molecular formula C23H22N2O5 and a molecular weight of 406.44 g/mol. Its IUPAC name is dimethyl 2-[3-(3-methoxyphenyl)-5-phenyl-1H-pyrazol-4-yl]cyclopropane-1,1-dicarboxylate.
| Compound Name | dimethyl 2-[3-(3-methoxyphenyl)-5-phenyl-1H-pyrazol-4-yl]cyclopropane-1,1-dicarboxylate |
|---|---|
| PubChem CID | 46188325 |
| Molecular Formula | C23H22N2O5 |
| Molecular Weight | 406.44 g/mol |
| Exact Mass | 406.15 |
| IUPAC Name | dimethyl 2-[3-(3-methoxyphenyl)-5-phenyl-1H-pyrazol-4-yl]cyclopropane-1,1-dicarboxylate |
| SMILES | COC(=O)C1(C(=O)OC)CC1c1c(-c2cccc(OC)c2)n[nH]c1-c1ccccc1 |
| InChI | InChI=1S/C23H22N2O5/c1-28-16-11-7-10-15(12-16)20-18(19(24-25-20)14-8-5-4-6-9-14)17-13-23(17,21(26)29-2)22(27)30-3/h4-12,17H,13H2,1-3H3,(H,24,25) |
| InChIKey | CFKXSUIJWMWZGZ-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 90.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.44 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|