C11H11BrO2 — CID 102133366
methyl (2R)-1-bromo-2-phenylcyclopropane-1-carboxylate (PubChem CID 102133366) has the molecular formula C11H11BrO2 and a molecular weight of 255.11 g/mol. Its IUPAC name is methyl (2R)-1-bromo-2-phenylcyclopropane-1-carboxylate.
| Compound Name | methyl (2R)-1-bromo-2-phenylcyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 102133366 |
| Molecular Formula | C11H11BrO2 |
| Molecular Weight | 255.11 g/mol |
| Exact Mass | 253.99 |
| IUPAC Name | methyl (2R)-1-bromo-2-phenylcyclopropane-1-carboxylate |
| SMILES | COC(=O)C1(Br)C[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C11H11BrO2/c1-14-10(13)11(12)7-9(11)8-5-3-2-4-6-8/h2-6,9H,7H2,1H3/t9-,11?/m1/s1 |
| InChIKey | ONEGPXMRIPLKCR-BFHBGLAWSA-N |
| XLogP | 2.48 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.11 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|