C17H23BrO2 — CID 102232951
cis-2,4-dimethylpentan-3-yl (1S,2S)-1-bromo-2-phenylcyclopropane-1-carboxylate (PubChem CID 102232951) has the molecular formula C17H23BrO2 and a molecular weight of 339.27 g/mol. Its IUPAC name is cis-2,4-dimethylpentan-3-yl (1S,2S)-1-bromo-2-phenylcyclopropane-1-carboxylate.
| Compound Name | cis-2,4-dimethylpentan-3-yl (1S,2S)-1-bromo-2-phenylcyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 102232951 |
| Molecular Formula | C17H23BrO2 |
| Molecular Weight | 339.27 g/mol |
| Exact Mass | 338.09 |
| IUPAC Name | cis-2,4-dimethylpentan-3-yl (1S,2S)-1-bromo-2-phenylcyclopropane-1-carboxylate |
| SMILES | CC(C)C(OC(=O)[C@]1(Br)C[C@H]1c1ccccc1)C(C)C |
| InChI | InChI=1S/C17H23BrO2/c1-11(2)15(12(3)4)20-16(19)17(18)10-14(17)13-8-6-5-7-9-13/h5-9,11-12,14-15H,10H2,1-4H3/t14-,17-/m0/s1 |
| InChIKey | QXEAWUNGDDLXEG-YOEHRIQHSA-N |
| XLogP | 4.53 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.27 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|