C22H25NO2 — CID 134962694
methyl (1R,3S,5S,8S)-3-methyl-1,5-diphenyl-1,2,3,5,6,7-hexahydropyrrolizine-8-carboxylate (PubChem CID 134962694) has the molecular formula C22H25NO2 and a molecular weight of 335.45 g/mol. Its IUPAC name is methyl (1R,3S,5S,8S)-3-methyl-1,5-diphenyl-1,2,3,5,6,7-hexahydropyrrolizine-8-carboxylate.
| Compound Name | methyl (1R,3S,5S,8S)-3-methyl-1,5-diphenyl-1,2,3,5,6,7-hexahydropyrrolizine-8-carboxylate |
|---|---|
| PubChem CID | 134962694 |
| Molecular Formula | C22H25NO2 |
| Molecular Weight | 335.45 g/mol |
| Exact Mass | 335.19 |
| IUPAC Name | methyl (1R,3S,5S,8S)-3-methyl-1,5-diphenyl-1,2,3,5,6,7-hexahydropyrrolizine-8-carboxylate |
| SMILES | COC(=O)[C@@]12CC[C@@H](c3ccccc3)N1[C@@H](C)C[C@@H]2c1ccccc1 |
| InChI | InChI=1S/C22H25NO2/c1-16-15-19(17-9-5-3-6-10-17)22(21(24)25-2)14-13-20(23(16)22)18-11-7-4-8-12-18/h3-12,16,19-20H,13-15H2,1-2H3/t16-,19+,20-,22-/m0/s1 |
| InChIKey | XIPRSEDSAMJEDP-SZFLOTBDSA-N |
| XLogP | 4.31 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.45 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |