C14H16O3 — CID 134847031
methyl (3R,5S)-5-methoxy-3-phenylcyclopentene-1-carboxylate (PubChem CID 134847031) has the molecular formula C14H16O3 and a molecular weight of 232.28 g/mol. Its IUPAC name is methyl (3R,5S)-5-methoxy-3-phenylcyclopentene-1-carboxylate.
| Compound Name | methyl (3R,5S)-5-methoxy-3-phenylcyclopentene-1-carboxylate |
|---|---|
| PubChem CID | 134847031 |
| Molecular Formula | C14H16O3 |
| Molecular Weight | 232.28 g/mol |
| Exact Mass | 232.11 |
| IUPAC Name | methyl (3R,5S)-5-methoxy-3-phenylcyclopentene-1-carboxylate |
| SMILES | COC(=O)C1=C[C@H](c2ccccc2)C[C@@H]1OC |
| InChI | InChI=1S/C14H16O3/c1-16-13-9-11(8-12(13)14(15)17-2)10-6-4-3-5-7-10/h3-8,11,13H,9H2,1-2H3/t11-,13-/m0/s1 |
| InChIKey | CEAIQYSKZSEQQZ-AAEUAGOBSA-N |
| XLogP | 2.29 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.28 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |