C23H36O3Si — CID 71714778
methyl 4-phenyl-2-[tri(propan-2-yl)silylmethyl]-3,4-dihydro-2H-pyran-6-carboxylate (PubChem CID 71714778) has the molecular formula C23H36O3Si and a molecular weight of 388.62 g/mol. Its IUPAC name is methyl 4-phenyl-2-[tri(propan-2-yl)silylmethyl]-3,4-dihydro-2H-pyran-6-carboxylate.
| Compound Name | methyl 4-phenyl-2-[tri(propan-2-yl)silylmethyl]-3,4-dihydro-2H-pyran-6-carboxylate |
|---|---|
| PubChem CID | 71714778 |
| Molecular Formula | C23H36O3Si |
| Molecular Weight | 388.62 g/mol |
| Exact Mass | 388.24 |
| IUPAC Name | methyl 4-phenyl-2-[tri(propan-2-yl)silylmethyl]-3,4-dihydro-2H-pyran-6-carboxylate |
| SMILES | COC(=O)C1=CC(c2ccccc2)CC(C[Si](C(C)C)(C(C)C)C(C)C)O1 |
| InChI | InChI=1S/C23H36O3Si/c1-16(2)27(17(3)4,18(5)6)15-21-13-20(19-11-9-8-10-12-19)14-22(26-21)23(24)25-7/h8-12,14,16-18,20-21H,13,15H2,1-7H3 |
| InChIKey | FLJDJWMRWSHOLT-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.62 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|