C24H25NO5 — CID 102157062
methyl (2R,3S,4S)-2-[(4R)-4-ethyl-2-oxo-1,3-oxazolidin-3-yl]-3,4-diphenyl-3,4-dihydro-2H-pyran-6-carboxylate (PubChem CID 102157062) has the molecular formula C24H25NO5 and a molecular weight of 407.47 g/mol. Its IUPAC name is methyl (2R,3S,4S)-2-[(4R)-4-ethyl-2-oxo-1,3-oxazolidin-3-yl]-3,4-diphenyl-3,4-dihydro-2H-pyran-6-carboxylate.
| Compound Name | methyl (2R,3S,4S)-2-[(4R)-4-ethyl-2-oxo-1,3-oxazolidin-3-yl]-3,4-diphenyl-3,4-dihydro-2H-pyran-6-carboxylate |
|---|---|
| PubChem CID | 102157062 |
| Molecular Formula | C24H25NO5 |
| Molecular Weight | 407.47 g/mol |
| Exact Mass | 407.17 |
| IUPAC Name | methyl (2R,3S,4S)-2-[(4R)-4-ethyl-2-oxo-1,3-oxazolidin-3-yl]-3,4-diphenyl-3,4-dihydro-2H-pyran-6-carboxylate |
| SMILES | CC[C@@H]1COC(=O)N1[C@@H]1OC(C(=O)OC)=C[C@H](c2ccccc2)[C@H]1c1ccccc1 |
| InChI | InChI=1S/C24H25NO5/c1-3-18-15-29-24(27)25(18)22-21(17-12-8-5-9-13-17)19(16-10-6-4-7-11-16)14-20(30-22)23(26)28-2/h4-14,18-19,21-22H,3,15H2,1-2H3/t18-,19-,21-,22-/m1/s1 |
| InChIKey | IUQMXLGIOVFEOB-UGESXGAOSA-N |
| XLogP | 4.20 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.47 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |