C17H17NO6 — CID 641843
methyl (2R,4R)-4-(1,3-dioxoisoindol-2-yl)-2-ethoxy-3,4-dihydro-2H-pyran-6-carboxylate (PubChem CID 641843) has the molecular formula C17H17NO6 and a molecular weight of 331.32 g/mol. Its IUPAC name is methyl (2R,4R)-4-(1,3-dioxoisoindol-2-yl)-2-ethoxy-3,4-dihydro-2H-pyran-6-carboxylate.
| Compound Name | methyl (2R,4R)-4-(1,3-dioxoisoindol-2-yl)-2-ethoxy-3,4-dihydro-2H-pyran-6-carboxylate |
|---|---|
| PubChem CID | 641843 |
| Molecular Formula | C17H17NO6 |
| Molecular Weight | 331.32 g/mol |
| Exact Mass | 331.11 |
| IUPAC Name | methyl (2R,4R)-4-(1,3-dioxoisoindol-2-yl)-2-ethoxy-3,4-dihydro-2H-pyran-6-carboxylate |
| SMILES | CCO[C@H]1C[C@@H](N2C(=O)c3ccccc3C2=O)C=C(C(=O)OC)O1 |
| InChI | InChI=1S/C17H17NO6/c1-3-23-14-9-10(8-13(24-14)17(21)22-2)18-15(19)11-6-4-5-7-12(11)16(18)20/h4-8,10,14H,3,9H2,1-2H3/t10-,14+/m0/s1 |
| InChIKey | AOLVBAWKTBCKKR-IINYFYTJSA-N |
| XLogP | 1.49 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.32 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|