About methyl 2-acetyl-6-ethoxy-5,6-dihydrooxazine-4-carboxylate
methyl 2-acetyl-6-ethoxy-5,6-dihydrooxazine-4-carboxylate (PubChem CID 11183794) has the molecular formula C10H15NO5
and a molecular weight of 229.23 g/mol. Its IUPAC name is methyl 2-acetyl-6-ethoxy-5,6-dihydrooxazine-4-carboxylate.
Analyze methyl 2-acetyl-6-ethoxy-5,6-dihydrooxazine-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-acetyl-6-ethoxy-5,6-dihydrooxazine-4-carboxylate?
The IUPAC name of methyl 2-acetyl-6-ethoxy-5,6-dihydrooxazine-4-carboxylate (CID 11183794) is methyl 2-acetyl-6-ethoxy-5,6-dihydrooxazine-4-carboxylate.
What is the SMILES notation for methyl 2-acetyl-6-ethoxy-5,6-dihydrooxazine-4-carboxylate?
The canonical SMILES for methyl 2-acetyl-6-ethoxy-5,6-dihydrooxazine-4-carboxylate is CCOC1CC(C(=O)OC)=CN(C(C)=O)O1.
What is the InChIKey of methyl 2-acetyl-6-ethoxy-5,6-dihydrooxazine-4-carboxylate?
The InChIKey is ZEGGUCPKYLFXKR-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15NO5/c1-4-15-9-5-8(10(13)14-3)6-11(16-9)7(2)12/h6,9H,4-5H2,1-3H3.
What are the key properties of methyl 2-acetyl-6-ethoxy-5,6-dihydrooxazine-4-carboxylate?
methyl 2-acetyl-6-ethoxy-5,6-dihydrooxazine-4-carboxylate has a molecular weight of 229.23 g/mol, XLogP of 0.59, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-acetyl-6-ethoxy-5,6-dihydrooxazine-4-carboxylate is sourced from PubChem (CID 11183794), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).