methyl (2R)-2-methyl-2,3-dihydrofuran-4-carboxylate

C7H10O3 — CID 97303919

IUPACmethyl (2R)-2-methyl-2,3-dihydrofuran-4-carboxylate
SMILESCOC(=O)C1=CO[C@H](C)C1
InChIInChI=1S/C7H10O3/c1-5-3-6(4-10-5)7(8)9-2/h4-5H,3H2,1-2H3/t5-/m1/s1
InChIKeyBXHDZRGFLHEGDT-RXMQYKEDSA-N
MW142.15 g/mol
LogP0.85
Rot. Bonds1

About methyl (2R)-2-methyl-2,3-dihydrofuran-4-carboxylate

methyl (2R)-2-methyl-2,3-dihydrofuran-4-carboxylate (PubChem CID 97303919) has the molecular formula C7H10O3 and a molecular weight of 142.15 g/mol. Its IUPAC name is methyl (2R)-2-methyl-2,3-dihydrofuran-4-carboxylate.

Molecular Properties

Compound Namemethyl (2R)-2-methyl-2,3-dihydrofuran-4-carboxylate
PubChem CID97303919
Molecular FormulaC7H10O3
Molecular Weight142.15 g/mol
Exact Mass142.06
IUPAC Namemethyl (2R)-2-methyl-2,3-dihydrofuran-4-carboxylate
SMILESCOC(=O)C1=CO[C@H](C)C1
InChIInChI=1S/C7H10O3/c1-5-3-6(4-10-5)7(8)9-2/h4-5H,3H2,1-2H3/t5-/m1/s1
InChIKeyBXHDZRGFLHEGDT-RXMQYKEDSA-N
XLogP0.85
TPSA35.53 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms10
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500142.15
LogP ≤ 50.85
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Analyze methyl (2R)-2-methyl-2,3-dihydrofuran-4-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl (2R)-2-methyl-2,3-dihydrofuran-4-carboxylate?
The IUPAC name of methyl (2R)-2-methyl-2,3-dihydrofuran-4-carboxylate (CID 97303919) is methyl (2R)-2-methyl-2,3-dihydrofuran-4-carboxylate.
What is the SMILES notation for methyl (2R)-2-methyl-2,3-dihydrofuran-4-carboxylate?
The canonical SMILES for methyl (2R)-2-methyl-2,3-dihydrofuran-4-carboxylate is COC(=O)C1=CO[C@H](C)C1.
What is the InChIKey of methyl (2R)-2-methyl-2,3-dihydrofuran-4-carboxylate?
The InChIKey is BXHDZRGFLHEGDT-RXMQYKEDSA-N. The full InChI is InChI=1S/C7H10O3/c1-5-3-6(4-10-5)7(8)9-2/h4-5H,3H2,1-2H3/t5-/m1/s1.
What are the key properties of methyl (2R)-2-methyl-2,3-dihydrofuran-4-carboxylate?
methyl (2R)-2-methyl-2,3-dihydrofuran-4-carboxylate has a molecular weight of 142.15 g/mol, XLogP of 0.85, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (2R)-2-methyl-2,3-dihydrofuran-4-carboxylate is sourced from PubChem (CID 97303919), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).