About dimethyl (8aS)-1,8a-dihydronaphthalene-2,6-dicarboxylate
dimethyl (8aS)-1,8a-dihydronaphthalene-2,6-dicarboxylate (PubChem CID 89335512) has the molecular formula C14H14O4
and a molecular weight of 246.26 g/mol. Its IUPAC name is dimethyl (8aS)-1,8a-dihydronaphthalene-2,6-dicarboxylate.
Molecular Properties
| Compound Name | dimethyl (8aS)-1,8a-dihydronaphthalene-2,6-dicarboxylate |
| PubChem CID | 89335512 |
| Molecular Formula | C14H14O4 |
| Molecular Weight | 246.26 g/mol |
| Exact Mass | 246.09 |
| IUPAC Name | dimethyl (8aS)-1,8a-dihydronaphthalene-2,6-dicarboxylate |
| SMILES | COC(=O)C1=CC2=CC=C(C(=O)OC)C[C@H]2C=C1 |
| InChI | InChI=1S/C14H14O4/c1-17-13(15)11-5-3-10-8-12(14(16)18-2)6-4-9(10)7-11/h3-7,10H,8H2,1-2H3/t10-/m1/s1 |
| InChIKey | WBQNPUNHDYIRRR-SNVBAGLBSA-N |
| XLogP | 1.70 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.26 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze dimethyl (8aS)-1,8a-dihydronaphthalene-2,6-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethyl (8aS)-1,8a-dihydronaphthalene-2,6-dicarboxylate?
The IUPAC name of dimethyl (8aS)-1,8a-dihydronaphthalene-2,6-dicarboxylate (CID 89335512) is dimethyl (8aS)-1,8a-dihydronaphthalene-2,6-dicarboxylate.
What is the SMILES notation for dimethyl (8aS)-1,8a-dihydronaphthalene-2,6-dicarboxylate?
The canonical SMILES for dimethyl (8aS)-1,8a-dihydronaphthalene-2,6-dicarboxylate is COC(=O)C1=CC2=CC=C(C(=O)OC)C[C@H]2C=C1.
What is the InChIKey of dimethyl (8aS)-1,8a-dihydronaphthalene-2,6-dicarboxylate?
The InChIKey is WBQNPUNHDYIRRR-SNVBAGLBSA-N. The full InChI is InChI=1S/C14H14O4/c1-17-13(15)11-5-3-10-8-12(14(16)18-2)6-4-9(10)7-11/h3-7,10H,8H2,1-2H3/t10-/m1/s1.
What are the key properties of dimethyl (8aS)-1,8a-dihydronaphthalene-2,6-dicarboxylate?
dimethyl (8aS)-1,8a-dihydronaphthalene-2,6-dicarboxylate has a molecular weight of 246.26 g/mol, XLogP of 1.70, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for dimethyl (8aS)-1,8a-dihydronaphthalene-2,6-dicarboxylate is sourced from PubChem (CID 89335512), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).