C14H14O4 — CID 89335512
dimethyl (8aS)-1,8a-dihydronaphthalene-2,6-dicarboxylate (PubChem CID 89335512) has the molecular formula C14H14O4 and a molecular weight of 246.26 g/mol. Its IUPAC name is dimethyl (8aS)-1,8a-dihydronaphthalene-2,6-dicarboxylate.
| Compound Name | dimethyl (8aS)-1,8a-dihydronaphthalene-2,6-dicarboxylate |
|---|---|
| PubChem CID | 89335512 |
| Molecular Formula | C14H14O4 |
| Molecular Weight | 246.26 g/mol |
| Exact Mass | 246.09 |
| IUPAC Name | dimethyl (8aS)-1,8a-dihydronaphthalene-2,6-dicarboxylate |
| SMILES | COC(=O)C1=CC2=CC=C(C(=O)OC)C[C@H]2C=C1 |
| InChI | InChI=1S/C14H14O4/c1-17-13(15)11-5-3-10-8-12(14(16)18-2)6-4-9(10)7-11/h3-7,10H,8H2,1-2H3/t10-/m1/s1 |
| InChIKey | WBQNPUNHDYIRRR-SNVBAGLBSA-N |
| XLogP | 1.70 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.26 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |