C11H15NO2 — CID 135144533
methyl 1,2,3,4,4a,5-hexahydroquinoline-6-carboxylate (PubChem CID 135144533) has the molecular formula C11H15NO2 and a molecular weight of 193.25 g/mol. Its IUPAC name is methyl 1,2,3,4,4a,5-hexahydroquinoline-6-carboxylate.
| Compound Name | methyl 1,2,3,4,4a,5-hexahydroquinoline-6-carboxylate |
|---|---|
| PubChem CID | 135144533 |
| Molecular Formula | C11H15NO2 |
| Molecular Weight | 193.25 g/mol |
| Exact Mass | 193.11 |
| IUPAC Name | methyl 1,2,3,4,4a,5-hexahydroquinoline-6-carboxylate |
| SMILES | COC(=O)C1=CC=C2NCCCC2C1 |
| InChI | InChI=1S/C11H15NO2/c1-14-11(13)9-4-5-10-8(7-9)3-2-6-12-10/h4-5,8,12H,2-3,6-7H2,1H3 |
| InChIKey | HOCHWCJKLORPDT-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.25 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |