C7H8ClNO2 — CID 138482360
methyl 2-chloro-1,2-dihydropyridine-5-carboxylate (PubChem CID 138482360) has the molecular formula C7H8ClNO2 and a molecular weight of 173.60 g/mol. Its IUPAC name is methyl 2-chloro-1,2-dihydropyridine-5-carboxylate.
| Compound Name | methyl 2-chloro-1,2-dihydropyridine-5-carboxylate |
|---|---|
| PubChem CID | 138482360 |
| Molecular Formula | C7H8ClNO2 |
| Molecular Weight | 173.60 g/mol |
| Exact Mass | 173.02 |
| IUPAC Name | methyl 2-chloro-1,2-dihydropyridine-5-carboxylate |
| SMILES | COC(=O)C1=CNC(Cl)C=C1 |
| InChI | InChI=1S/C7H8ClNO2/c1-11-7(10)5-2-3-6(8)9-4-5/h2-4,6,9H,1H3 |
| InChIKey | SRCRVFPYOWTZQF-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.60 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|