C12H16O6 — CID 15577366
dimethyl 3,6-dimethoxycyclohexa-1,4-diene-1,2-dicarboxylate (PubChem CID 15577366) has the molecular formula C12H16O6 and a molecular weight of 256.25 g/mol. Its IUPAC name is dimethyl 3,6-dimethoxycyclohexa-1,4-diene-1,2-dicarboxylate.
| Compound Name | dimethyl 3,6-dimethoxycyclohexa-1,4-diene-1,2-dicarboxylate |
|---|---|
| PubChem CID | 15577366 |
| Molecular Formula | C12H16O6 |
| Molecular Weight | 256.25 g/mol |
| Exact Mass | 256.09 |
| IUPAC Name | dimethyl 3,6-dimethoxycyclohexa-1,4-diene-1,2-dicarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)C(OC)C=CC1OC |
| InChI | InChI=1S/C12H16O6/c1-15-7-5-6-8(16-2)10(12(14)18-4)9(7)11(13)17-3/h5-8H,1-4H3 |
| InChIKey | DHRXNSJPMWPVEP-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.25 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|