C16H14O4 — CID 596148
dimethyl tetracyclo[4.2.2.22,5.01,6]dodeca-3,7,9,11-tetraene-3,4-dicarboxylate (PubChem CID 596148) has the molecular formula C16H14O4 and a molecular weight of 270.28 g/mol. Its IUPAC name is dimethyl tetracyclo[4.2.2.22,5.01,6]dodeca-3,7,9,11-tetraene-3,4-dicarboxylate.
| Compound Name | dimethyl tetracyclo[4.2.2.22,5.01,6]dodeca-3,7,9,11-tetraene-3,4-dicarboxylate |
|---|---|
| PubChem CID | 596148 |
| Molecular Formula | C16H14O4 |
| Molecular Weight | 270.28 g/mol |
| Exact Mass | 270.09 |
| IUPAC Name | dimethyl tetracyclo[4.2.2.22,5.01,6]dodeca-3,7,9,11-tetraene-3,4-dicarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)C2C=CC1C13C=CC21C=C3 |
| InChI | InChI=1S/C16H14O4/c1-19-13(17)11-9-3-4-10(12(11)14(18)20-2)16-7-5-15(9,16)6-8-16/h3-10H,1-2H3 |
| InChIKey | MMBDHRGWNOENQK-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.28 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|