C13H12O6 — CID 134859462
dimethyl 5-hydroxy-4-oxobicyclo[3.2.2]nona-2,6,8-triene-6,7-dicarboxylate (PubChem CID 134859462) has the molecular formula C13H12O6 and a molecular weight of 264.23 g/mol. Its IUPAC name is dimethyl 5-hydroxy-4-oxobicyclo[3.2.2]nona-2,6,8-triene-6,7-dicarboxylate.
| Compound Name | dimethyl 5-hydroxy-4-oxobicyclo[3.2.2]nona-2,6,8-triene-6,7-dicarboxylate |
|---|---|
| PubChem CID | 134859462 |
| Molecular Formula | C13H12O6 |
| Molecular Weight | 264.23 g/mol |
| Exact Mass | 264.06 |
| IUPAC Name | dimethyl 5-hydroxy-4-oxobicyclo[3.2.2]nona-2,6,8-triene-6,7-dicarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)C2(O)C=CC1C=CC2=O |
| InChI | InChI=1S/C13H12O6/c1-18-11(15)9-7-3-4-8(14)13(17,6-5-7)10(9)12(16)19-2/h3-7,17H,1-2H3 |
| InChIKey | FWWIZVMUFGCSDD-UHFFFAOYSA-N |
| XLogP | -0.31 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.23 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|