C16H18O8 — CID 11823946
dimethyl (1S,4R,7S,8S)-7,8-diacetyloxybicyclo[2.2.2]octa-2,5-diene-2,3-dicarboxylate (PubChem CID 11823946) has the molecular formula C16H18O8 and a molecular weight of 338.31 g/mol. Its IUPAC name is dimethyl (1S,4R,7S,8S)-7,8-diacetyloxybicyclo[2.2.2]octa-2,5-diene-2,3-dicarboxylate.
| Compound Name | dimethyl (1S,4R,7S,8S)-7,8-diacetyloxybicyclo[2.2.2]octa-2,5-diene-2,3-dicarboxylate |
|---|---|
| PubChem CID | 11823946 |
| Molecular Formula | C16H18O8 |
| Molecular Weight | 338.31 g/mol |
| Exact Mass | 338.10 |
| IUPAC Name | dimethyl (1S,4R,7S,8S)-7,8-diacetyloxybicyclo[2.2.2]octa-2,5-diene-2,3-dicarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)[C@@H]2C=C[C@H]1[C@H](OC(C)=O)[C@H]2OC(C)=O |
| InChI | InChI=1S/C16H18O8/c1-7(17)23-13-9-5-6-10(14(13)24-8(2)18)12(16(20)22-4)11(9)15(19)21-3/h5-6,9-10,13-14H,1-4H3/t9-,10+,13-,14-/m0/s1 |
| InChIKey | GQTONRJOJIGHNS-DJBIQUGXSA-N |
| XLogP | 0.31 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.31 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|