C18H18O4 — CID 117069482
dimethyl (1R,8S,11R,14S)-tetracyclo[6.5.1.02,7.011,14]tetradeca-3,6,9,12-tetraene-3,4-dicarboxylate (PubChem CID 117069482) has the molecular formula C18H18O4 and a molecular weight of 298.34 g/mol. Its IUPAC name is dimethyl (1R,8S,11R,14S)-tetracyclo[6.5.1.02,7.011,14]tetradeca-3,6,9,12-tetraene-3,4-dicarboxylate.
| Compound Name | dimethyl (1R,8S,11R,14S)-tetracyclo[6.5.1.02,7.011,14]tetradeca-3,6,9,12-tetraene-3,4-dicarboxylate |
|---|---|
| PubChem CID | 117069482 |
| Molecular Formula | C18H18O4 |
| Molecular Weight | 298.34 g/mol |
| Exact Mass | 298.12 |
| IUPAC Name | dimethyl (1R,8S,11R,14S)-tetracyclo[6.5.1.02,7.011,14]tetradeca-3,6,9,12-tetraene-3,4-dicarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)C2C(=CC1)[C@H]1C=C[C@H]3C=C[C@@H]2[C@H]31 |
| InChI | InChI=1S/C18H18O4/c1-21-17(19)13-8-7-11-10-5-3-9-4-6-12(14(9)10)15(11)16(13)18(20)22-2/h3-7,9-10,12,14-15H,8H2,1-2H3/t9-,10+,12+,14+,15?/m0/s1 |
| InChIKey | FCHYOJOKOUARRP-CYYLAHJPSA-N |
| XLogP | 2.19 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.34 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|