C18H16O4 — CID 124920213
dimethyl (1R,8R,11S,14S)-tetracyclo[6.5.1.02,7.011,14]tetradeca-2(7),3,5,9,12-pentaene-3,4-dicarboxylate (PubChem CID 124920213) has the molecular formula C18H16O4 and a molecular weight of 296.32 g/mol. Its IUPAC name is dimethyl (1R,8R,11S,14S)-tetracyclo[6.5.1.02,7.011,14]tetradeca-2(7),3,5,9,12-pentaene-3,4-dicarboxylate.
| Compound Name | dimethyl (1R,8R,11S,14S)-tetracyclo[6.5.1.02,7.011,14]tetradeca-2(7),3,5,9,12-pentaene-3,4-dicarboxylate |
|---|---|
| PubChem CID | 124920213 |
| Molecular Formula | C18H16O4 |
| Molecular Weight | 296.32 g/mol |
| Exact Mass | 296.10 |
| IUPAC Name | dimethyl (1R,8R,11S,14S)-tetracyclo[6.5.1.02,7.011,14]tetradeca-2(7),3,5,9,12-pentaene-3,4-dicarboxylate |
| SMILES | COC(=O)c1ccc2c(c1C(=O)OC)[C@@H]1C=C[C@@H]3C=C[C@@H]2[C@H]31 |
| InChI | InChI=1S/C18H16O4/c1-21-17(19)13-8-7-11-10-5-3-9-4-6-12(14(9)10)15(11)16(13)18(20)22-2/h3-10,12,14H,1-2H3/t9-,10-,12+,14-/m0/s1 |
| InChIKey | RWBIISHJGDYLBK-XVMOGABASA-N |
| XLogP | 2.81 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.32 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|