C13H16O4 — CID 10633545
methyl (1R,7S)-4,4-dimethyl-3,5-dioxatricyclo[5.2.2.02,6]undeca-8,10-diene-8-carboxylate (PubChem CID 10633545) has the molecular formula C13H16O4 and a molecular weight of 236.27 g/mol. Its IUPAC name is methyl (1R,7S)-4,4-dimethyl-3,5-dioxatricyclo[5.2.2.02,6]undeca-8,10-diene-8-carboxylate.
| Compound Name | methyl (1R,7S)-4,4-dimethyl-3,5-dioxatricyclo[5.2.2.02,6]undeca-8,10-diene-8-carboxylate |
|---|---|
| PubChem CID | 10633545 |
| Molecular Formula | C13H16O4 |
| Molecular Weight | 236.27 g/mol |
| Exact Mass | 236.10 |
| IUPAC Name | methyl (1R,7S)-4,4-dimethyl-3,5-dioxatricyclo[5.2.2.02,6]undeca-8,10-diene-8-carboxylate |
| SMILES | COC(=O)C1=C[C@H]2C=C[C@@H]1C1OC(C)(C)OC12 |
| InChI | InChI=1S/C13H16O4/c1-13(2)16-10-7-4-5-8(11(10)17-13)9(6-7)12(14)15-3/h4-8,10-11H,1-3H3/t7-,8+,10?,11?/m1/s1 |
| InChIKey | ZJEAOTHUHLQJSS-NOFHBMEESA-N |
| XLogP | 1.42 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.27 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|