C10H12O4 — CID 89232441
(2R,6R)-4,4-dimethyl-3,5,8-trioxatricyclo[5.2.2.02,6]undec-10-en-9-one (PubChem CID 89232441) has the molecular formula C10H12O4 and a molecular weight of 196.20 g/mol. Its IUPAC name is (2R,6R)-4,4-dimethyl-3,5,8-trioxatricyclo[5.2.2.02,6]undec-10-en-9-one.
| Compound Name | (2R,6R)-4,4-dimethyl-3,5,8-trioxatricyclo[5.2.2.02,6]undec-10-en-9-one |
|---|---|
| PubChem CID | 89232441 |
| Molecular Formula | C10H12O4 |
| Molecular Weight | 196.20 g/mol |
| Exact Mass | 196.07 |
| IUPAC Name | (2R,6R)-4,4-dimethyl-3,5,8-trioxatricyclo[5.2.2.02,6]undec-10-en-9-one |
| SMILES | CC1(C)O[C@@H]2C3C=CC(OC3=O)[C@@H]2O1 |
| InChI | InChI=1S/C10H12O4/c1-10(2)13-7-5-3-4-6(8(7)14-10)12-9(5)11/h3-8H,1-2H3/t5?,6?,7-,8+/m1/s1 |
| InChIKey | OYRSIXNMTBQURU-CRYROECRSA-N |
| XLogP | 0.62 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.20 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|