C17H17NO5 — CID 101486706
(1S,13R,14S,18R)-16,16-dimethyl-5,7,15,17-tetraoxa-12-azapentacyclo[11.7.0.02,10.04,8.014,18]icosa-2,4(8),9,19-tetraen-11-one (PubChem CID 101486706) has the molecular formula C17H17NO5 and a molecular weight of 315.33 g/mol. Its IUPAC name is (1S,13R,14S,18R)-16,16-dimethyl-5,7,15,17-tetraoxa-12-azapentacyclo[11.7.0.02,10.04,8.014,18]icosa-2,4(8),9,19-tetraen-11-one.
| Compound Name | (1S,13R,14S,18R)-16,16-dimethyl-5,7,15,17-tetraoxa-12-azapentacyclo[11.7.0.02,10.04,8.014,18]icosa-2,4(8),9,19-tetraen-11-one |
|---|---|
| PubChem CID | 101486706 |
| Molecular Formula | C17H17NO5 |
| Molecular Weight | 315.33 g/mol |
| Exact Mass | 315.11 |
| IUPAC Name | (1S,13R,14S,18R)-16,16-dimethyl-5,7,15,17-tetraoxa-12-azapentacyclo[11.7.0.02,10.04,8.014,18]icosa-2,4(8),9,19-tetraen-11-one |
| SMILES | CC1(C)O[C@H]2[C@@H]3NC(=O)c4cc5c(cc4[C@@H]3C=C[C@H]2O1)OCO5 |
| InChI | InChI=1S/C17H17NO5/c1-17(2)22-11-4-3-8-9-5-12-13(21-7-20-12)6-10(9)16(19)18-14(8)15(11)23-17/h3-6,8,11,14-15H,7H2,1-2H3,(H,18,19)/t8-,11+,14+,15+/m0/s1 |
| InChIKey | MSTPNCLMHSYGEY-UYJAGUKBSA-N |
| XLogP | 1.70 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.33 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|