C14H11IO4 — CID 102469070
(4R,4aR,11bS)-4-iodo-3,4,4a,11b-tetrahydro-[1,3]benzodioxolo[5,6-c]chromen-6-one (PubChem CID 102469070) has the molecular formula C14H11IO4 and a molecular weight of 370.14 g/mol. Its IUPAC name is (4R,4aR,11bS)-4-iodo-3,4,4a,11b-tetrahydro-[1,3]benzodioxolo[5,6-c]chromen-6-one.
| Compound Name | (4R,4aR,11bS)-4-iodo-3,4,4a,11b-tetrahydro-[1,3]benzodioxolo[5,6-c]chromen-6-one |
|---|---|
| PubChem CID | 102469070 |
| Molecular Formula | C14H11IO4 |
| Molecular Weight | 370.14 g/mol |
| Exact Mass | 369.97 |
| IUPAC Name | (4R,4aR,11bS)-4-iodo-3,4,4a,11b-tetrahydro-[1,3]benzodioxolo[5,6-c]chromen-6-one |
| SMILES | O=C1O[C@H]2[C@H](I)CC=C[C@H]2c2cc3c(cc21)OCO3 |
| InChI | InChI=1S/C14H11IO4/c15-10-3-1-2-7-8-4-11-12(18-6-17-11)5-9(8)14(16)19-13(7)10/h1-2,4-5,7,10,13H,3,6H2/t7-,10+,13+/m0/s1 |
| InChIKey | NSXMWGLQKMQQDB-JVQVWZCXSA-N |
| XLogP | 2.80 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.14 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|