C8H7IO3 — CID 150351814
4-iodo-3a,4,5,7a-tetrahydro-2-benzofuran-1,3-dione (PubChem CID 150351814) has the molecular formula C8H7IO3 and a molecular weight of 278.05 g/mol. Its IUPAC name is 4-iodo-3a,4,5,7a-tetrahydro-2-benzofuran-1,3-dione.
| Compound Name | 4-iodo-3a,4,5,7a-tetrahydro-2-benzofuran-1,3-dione |
|---|---|
| PubChem CID | 150351814 |
| Molecular Formula | C8H7IO3 |
| Molecular Weight | 278.05 g/mol |
| Exact Mass | 277.94 |
| IUPAC Name | 4-iodo-3a,4,5,7a-tetrahydro-2-benzofuran-1,3-dione |
| SMILES | O=C1OC(=O)C2C(I)CC=CC12 |
| InChI | InChI=1S/C8H7IO3/c9-5-3-1-2-4-6(5)8(11)12-7(4)10/h1-2,4-6H,3H2 |
| InChIKey | GTWWKRRYVLISGL-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.05 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|