C8H8O3S — CID 154161272
4-sulfanyl-3a,4,5,7a-tetrahydro-2-benzofuran-1,3-dione (PubChem CID 154161272) has the molecular formula C8H8O3S and a molecular weight of 184.22 g/mol. Its IUPAC name is 4-sulfanyl-3a,4,5,7a-tetrahydro-2-benzofuran-1,3-dione.
| Compound Name | 4-sulfanyl-3a,4,5,7a-tetrahydro-2-benzofuran-1,3-dione |
|---|---|
| PubChem CID | 154161272 |
| Molecular Formula | C8H8O3S |
| Molecular Weight | 184.22 g/mol |
| Exact Mass | 184.02 |
| IUPAC Name | 4-sulfanyl-3a,4,5,7a-tetrahydro-2-benzofuran-1,3-dione |
| SMILES | O=C1OC(=O)C2C(S)CC=CC12 |
| InChI | InChI=1S/C8H8O3S/c9-7-4-2-1-3-5(12)6(4)8(10)11-7/h1-2,4-6,12H,3H2 |
| InChIKey | LOLVLGHQHCLFCM-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 43.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.22 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|