C9H8CaO6 — CID 175319564
calcium;3a,4,5,7a-tetrahydro-2-benzofuran-1,3-dione;carbonate (PubChem CID 175319564) has the molecular formula C9H8CaO6 and a molecular weight of 252.23 g/mol. Its IUPAC name is calcium;3a,4,5,7a-tetrahydro-2-benzofuran-1,3-dione;carbonate.
| Compound Name | calcium;3a,4,5,7a-tetrahydro-2-benzofuran-1,3-dione;carbonate |
|---|---|
| PubChem CID | 175319564 |
| Molecular Formula | C9H8CaO6 |
| Molecular Weight | 252.23 g/mol |
| Exact Mass | 251.99 |
| IUPAC Name | calcium;3a,4,5,7a-tetrahydro-2-benzofuran-1,3-dione;carbonate |
| SMILES | O=C([O-])[O-].O=C1OC(=O)C2CCC=CC12.[Ca+2] |
| InChI | InChI=1S/C8H8O3.CH2O3.Ca/c9-7-5-3-1-2-4-6(5)8(10)11-7;2-1(3)4;/h1,3,5-6H,2,4H2;(H2,2,3,4);/q;;+2/p-2 |
| InChIKey | JOBHQBCFJLHJSH-UHFFFAOYSA-L |
| XLogP | -2.18 |
| TPSA | 106.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.23 |
| LogP ≤ 5 | -2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|