C13H12O2 — CID 101408860
(6aS,10aS)-6a,7,8,10a-tetrahydrobenzo[c]chromen-6-one (PubChem CID 101408860) has the molecular formula C13H12O2 and a molecular weight of 200.24 g/mol. Its IUPAC name is (6aS,10aS)-6a,7,8,10a-tetrahydrobenzo[c]chromen-6-one.
| Compound Name | (6aS,10aS)-6a,7,8,10a-tetrahydrobenzo[c]chromen-6-one |
|---|---|
| PubChem CID | 101408860 |
| Molecular Formula | C13H12O2 |
| Molecular Weight | 200.24 g/mol |
| Exact Mass | 200.08 |
| IUPAC Name | (6aS,10aS)-6a,7,8,10a-tetrahydrobenzo[c]chromen-6-one |
| SMILES | O=C1Oc2ccccc2[C@H]2C=CCC[C@H]12 |
| InChI | InChI=1S/C13H12O2/c14-13-11-7-2-1-5-9(11)10-6-3-4-8-12(10)15-13/h1,3-6,8-9,11H,2,7H2/t9-,11+/m1/s1 |
| InChIKey | XQKVBDFTTFNLNU-KOLCDFICSA-N |
| XLogP | 2.66 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.24 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|