C14H14O3 — CID 11896490
(6aR,7S,10aR)-7-methyl-7,8,10,10a-tetrahydro-6aH-benzo[c]chromene-6,9-dione (PubChem CID 11896490) has the molecular formula C14H14O3 and a molecular weight of 230.26 g/mol. Its IUPAC name is (6aR,7S,10aR)-7-methyl-7,8,10,10a-tetrahydro-6aH-benzo[c]chromene-6,9-dione.
| Compound Name | (6aR,7S,10aR)-7-methyl-7,8,10,10a-tetrahydro-6aH-benzo[c]chromene-6,9-dione |
|---|---|
| PubChem CID | 11896490 |
| Molecular Formula | C14H14O3 |
| Molecular Weight | 230.26 g/mol |
| Exact Mass | 230.09 |
| IUPAC Name | (6aR,7S,10aR)-7-methyl-7,8,10,10a-tetrahydro-6aH-benzo[c]chromene-6,9-dione |
| SMILES | C[C@H]1CC(=O)C[C@H]2c3ccccc3OC(=O)[C@H]12 |
| InChI | InChI=1S/C14H14O3/c1-8-6-9(15)7-11-10-4-2-3-5-12(10)17-14(16)13(8)11/h2-5,8,11,13H,6-7H2,1H3/t8-,11-,13+/m0/s1 |
| InChIKey | ANOJDUHFBKNOAI-LJUAHTATSA-N |
| XLogP | 2.30 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.26 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|