C14H10O4 — CID 98519836
(1R,8S,9R,13R)-11-oxatetracyclo[6.5.2.02,7.09,13]pentadeca-2,4,6-triene-10,12,14-trione (PubChem CID 98519836) has the molecular formula C14H10O4 and a molecular weight of 242.23 g/mol. Its IUPAC name is (1R,8S,9R,13R)-11-oxatetracyclo[6.5.2.02,7.09,13]pentadeca-2,4,6-triene-10,12,14-trione.
| Compound Name | (1R,8S,9R,13R)-11-oxatetracyclo[6.5.2.02,7.09,13]pentadeca-2,4,6-triene-10,12,14-trione |
|---|---|
| PubChem CID | 98519836 |
| Molecular Formula | C14H10O4 |
| Molecular Weight | 242.23 g/mol |
| Exact Mass | 242.06 |
| IUPAC Name | (1R,8S,9R,13R)-11-oxatetracyclo[6.5.2.02,7.09,13]pentadeca-2,4,6-triene-10,12,14-trione |
| SMILES | O=C1OC(=O)[C@H]2[C@H]1[C@@H]1CC(=O)[C@H]2c2ccccc21 |
| InChI | InChI=1S/C14H10O4/c15-9-5-8-6-3-1-2-4-7(6)10(9)12-11(8)13(16)18-14(12)17/h1-4,8,10-12H,5H2/t8-,10-,11-,12-/m1/s1 |
| InChIKey | NCIFOAQKJBQKSO-HJQYOEGKSA-N |
| XLogP | 1.16 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.23 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|